C19H38B2O4 — CID 90738803
2-[4-(3,3-dimethylhexyl)-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 90738803) has the molecular formula C19H38B2O4 and a molecular weight of 352.13 g/mol. Its IUPAC name is 2-[4-(3,3-dimethylhexyl)-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-(3,3-dimethylhexyl)-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 90738803 |
| Molecular Formula | C19H38B2O4 |
| Molecular Weight | 352.13 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | 2-[4-(3,3-dimethylhexyl)-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCC(C)(C)CCC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C19H38B2O4/c1-11-12-15(2,3)13-14-19(10)18(8,9)24-21(25-19)20-22-16(4,5)17(6,7)23-20/h11-14H2,1-10H3 |
| InChIKey | YNUUJWGMALBLQA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.13 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|