C20H23ClN4O6S — CID 90738877
6-chloro-2-hydroxy-N-methoxy-N-methyl-3-[[2-[3-(methylideneamino)hepta-3,5-dien-2-ylamino]-3,4-dioxocyclobuten-1-yl]amino]benzenesulfonamide (PubChem CID 90738877) has the molecular formula C20H23ClN4O6S and a molecular weight of 482.95 g/mol. Its IUPAC name is 6-chloro-2-hydroxy-N-methoxy-N-methyl-3-[[2-[3-(methylideneamino)hepta-3,5-dien-2-ylamino]-3,4-dioxocyclobuten-1-yl]amino]benzenesulfonamide.
| Compound Name | 6-chloro-2-hydroxy-N-methoxy-N-methyl-3-[[2-[3-(methylideneamino)hepta-3,5-dien-2-ylamino]-3,4-dioxocyclobuten-1-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 90738877 |
| Molecular Formula | C20H23ClN4O6S |
| Molecular Weight | 482.95 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 6-chloro-2-hydroxy-N-methoxy-N-methyl-3-[[2-[3-(methylideneamino)hepta-3,5-dien-2-ylamino]-3,4-dioxocyclobuten-1-yl]amino]benzenesulfonamide |
| SMILES | C=NC(=CC=CC)C(C)Nc1c(Nc2ccc(Cl)c(S(=O)(=O)N(C)OC)c2O)c(=O)c1=O |
| InChI | InChI=1S/C20H23ClN4O6S/c1-6-7-8-13(22-3)11(2)23-15-16(19(28)18(15)27)24-14-10-9-12(21)20(17(14)26)32(29,30)25(4)31-5/h6-11,23-24,26H,3H2,1-2,4-5H3 |
| InChIKey | CEXYIBNMGHIYJA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 137.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.95 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|