C20H23F4N5O3 — CID 90738992
N-[(5S)-5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]-3-methoxyquinoxaline-2-carboxamide (PubChem CID 90738992) has the molecular formula C20H23F4N5O3 and a molecular weight of 457.43 g/mol. Its IUPAC name is N-[(5S)-5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]-3-methoxyquinoxaline-2-carboxamide.
| Compound Name | N-[(5S)-5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]-3-methoxyquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 90738992 |
| Molecular Formula | C20H23F4N5O3 |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | N-[(5S)-5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]-3-methoxyquinoxaline-2-carboxamide |
| SMILES | COc1nc2ccccc2nc1C(=O)NCCCC[C@H](N)C(=O)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C20H23F4N5O3/c1-32-17-15(27-13-7-2-3-8-14(13)28-17)16(30)26-9-5-4-6-12(25)18(31)29-10-19(21,22)20(23,24)11-29/h2-3,7-8,12H,4-6,9-11,25H2,1H3,(H,26,30)/t12-/m0/s1 |
| InChIKey | QOGGKDNTSDKHGG-LBPRGKRZSA-N |
| XLogP | 1.98 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|