C23H29F2NO5S — CID 90739403
methyl 7-[(1R,2R)-2-[(3R)-4-(2,4-difluorophenyl)sulfanyl-3-hydroxybutyl]-3-nitroso-5-oxocyclopentyl]hept-5-enoate (PubChem CID 90739403) has the molecular formula C23H29F2NO5S and a molecular weight of 469.55 g/mol. Its IUPAC name is methyl 7-[(1R,2R)-2-[(3R)-4-(2,4-difluorophenyl)sulfanyl-3-hydroxybutyl]-3-nitroso-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R)-2-[(3R)-4-(2,4-difluorophenyl)sulfanyl-3-hydroxybutyl]-3-nitroso-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 90739403 |
| Molecular Formula | C23H29F2NO5S |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | methyl 7-[(1R,2R)-2-[(3R)-4-(2,4-difluorophenyl)sulfanyl-3-hydroxybutyl]-3-nitroso-5-oxocyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CC[C@H]1C(=O)CC(N=O)[C@@H]1CC[C@@H](O)CSc1ccc(F)cc1F |
| InChI | InChI=1S/C23H29F2NO5S/c1-31-23(29)7-5-3-2-4-6-18-17(20(26-30)13-21(18)28)10-9-16(27)14-32-22-11-8-15(24)12-19(22)25/h2,4,8,11-12,16-18,20,27H,3,5-7,9-10,13-14H2,1H3/t16-,17-,18-,20?/m1/s1 |
| InChIKey | CAGTWFFSOYYBSX-KYJJNMIMSA-N |
| XLogP | 4.83 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|