About N,6-diethyl-11-(2-penta-1,4-dien-2-ylcyclopropyl)-3-propylundecan-1-amine
N,6-diethyl-11-(2-penta-1,4-dien-2-ylcyclopropyl)-3-propylundecan-1-amine (PubChem CID 90739406) has the molecular formula C26H49N
and a molecular weight of 375.69 g/mol. Its IUPAC name is N,6-diethyl-11-(2-penta-1,4-dien-2-ylcyclopropyl)-3-propylundecan-1-amine.
Molecular Properties
| Compound Name | N,6-diethyl-11-(2-penta-1,4-dien-2-ylcyclopropyl)-3-propylundecan-1-amine |
| PubChem CID | 90739406 |
| Molecular Formula | C26H49N |
| Molecular Weight | 375.69 g/mol |
| Exact Mass | 375.39 |
| IUPAC Name | N,6-diethyl-11-(2-penta-1,4-dien-2-ylcyclopropyl)-3-propylundecan-1-amine |
| SMILES | C=CCC(=C)C1CC1CCCCCC(CC)CCC(CCC)CCNCC |
| InChI | InChI=1S/C26H49N/c1-6-13-22(5)26-21-25(26)16-12-10-11-15-23(8-3)17-18-24(14-7-2)19-20-27-9-4/h6,23-27H,1,5,7-21H2,2-4H3 |
| InChIKey | HORUQHNCZVTPAG-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.69 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,6-diethyl-11-(2-penta-1,4-dien-2-ylcyclopropyl)-3-propylundecan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,6-diethyl-11-(2-penta-1,4-dien-2-ylcyclopropyl)-3-propylundecan-1-amine?
The IUPAC name of N,6-diethyl-11-(2-penta-1,4-dien-2-ylcyclopropyl)-3-propylundecan-1-amine (CID 90739406) is N,6-diethyl-11-(2-penta-1,4-dien-2-ylcyclopropyl)-3-propylundecan-1-amine.
What is the SMILES notation for N,6-diethyl-11-(2-penta-1,4-dien-2-ylcyclopropyl)-3-propylundecan-1-amine?
The canonical SMILES for N,6-diethyl-11-(2-penta-1,4-dien-2-ylcyclopropyl)-3-propylundecan-1-amine is C=CCC(=C)C1CC1CCCCCC(CC)CCC(CCC)CCNCC.
What is the InChIKey of N,6-diethyl-11-(2-penta-1,4-dien-2-ylcyclopropyl)-3-propylundecan-1-amine?
The InChIKey is HORUQHNCZVTPAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H49N/c1-6-13-22(5)26-21-25(26)16-12-10-11-15-23(8-3)17-18-24(14-7-2)19-20-27-9-4/h6,23-27H,1,5,7-21H2,2-4H3.
What are the key properties of N,6-diethyl-11-(2-penta-1,4-dien-2-ylcyclopropyl)-3-propylundecan-1-amine?
N,6-diethyl-11-(2-penta-1,4-dien-2-ylcyclopropyl)-3-propylundecan-1-amine has a molecular weight of 375.69 g/mol, XLogP of 7.93, 19 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,6-diethyl-11-(2-penta-1,4-dien-2-ylcyclopropyl)-3-propylundecan-1-amine is sourced from PubChem (CID 90739406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).