C19H24ClN4O2- — CID 90739443
2-[1-(4-chlorophenyl)pentylamino]-3-methoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 90739443) has the molecular formula C19H24ClN4O2- and a molecular weight of 375.88 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)pentylamino]-3-methoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-[1-(4-chlorophenyl)pentylamino]-3-methoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 90739443 |
| Molecular Formula | C19H24ClN4O2- |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-[1-(4-chlorophenyl)pentylamino]-3-methoxy-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CCCC[C-](Nc1nc2c(c(=O)n1OC)CNCC2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H24ClN4O2/c1-3-4-5-16(13-6-8-14(20)9-7-13)22-19-23-17-10-11-21-12-15(17)18(25)24(19)26-2/h6-9,21H,3-5,10-12H2,1-2H3,(H,22,23)/q-1 |
| InChIKey | CJPQQNYFEPWFAO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|