C8H10O4S — CID 90739456
3-thiabicyclo[3.2.0]heptane-6,7-dicarboxylic acid (PubChem CID 90739456) has the molecular formula C8H10O4S and a molecular weight of 202.23 g/mol. Its IUPAC name is 3-thiabicyclo[3.2.0]heptane-6,7-dicarboxylic acid.
| Compound Name | 3-thiabicyclo[3.2.0]heptane-6,7-dicarboxylic acid |
|---|---|
| PubChem CID | 90739456 |
| Molecular Formula | C8H10O4S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 3-thiabicyclo[3.2.0]heptane-6,7-dicarboxylic acid |
| SMILES | O=C(O)C1C2CSCC2C1C(=O)O |
| InChI | InChI=1S/C8H10O4S/c9-7(10)5-3-1-13-2-4(3)6(5)8(11)12/h3-6H,1-2H2,(H,9,10)(H,11,12) |
| InChIKey | VMJOCKSCVDTJCR-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |