About 4-phenyl-1-prop-2-enylpyridin-1-ium;1,4-xylene
4-phenyl-1-prop-2-enylpyridin-1-ium;1,4-xylene (PubChem CID 90739457) has the molecular formula C22H24N+
and a molecular weight of 302.44 g/mol. Its IUPAC name is 4-phenyl-1-prop-2-enylpyridin-1-ium;1,4-xylene.
Molecular Properties
| Compound Name | 4-phenyl-1-prop-2-enylpyridin-1-ium;1,4-xylene |
| PubChem CID | 90739457 |
| Molecular Formula | C22H24N+ |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 4-phenyl-1-prop-2-enylpyridin-1-ium;1,4-xylene |
| SMILES | C=CC[n+]1ccc(-c2ccccc2)cc1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C14H14N.C8H10/c1-2-10-15-11-8-14(9-12-15)13-6-4-3-5-7-13;1-7-3-5-8(2)6-4-7/h2-9,11-12H,1,10H2;3-6H,1-2H3/q+1; |
| InChIKey | WFBISTLIZPSVFI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyl-1-prop-2-enylpyridin-1-ium;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-1-prop-2-enylpyridin-1-ium;1,4-xylene?
The IUPAC name of 4-phenyl-1-prop-2-enylpyridin-1-ium;1,4-xylene (CID 90739457) is 4-phenyl-1-prop-2-enylpyridin-1-ium;1,4-xylene.
What is the SMILES notation for 4-phenyl-1-prop-2-enylpyridin-1-ium;1,4-xylene?
The canonical SMILES for 4-phenyl-1-prop-2-enylpyridin-1-ium;1,4-xylene is C=CC[n+]1ccc(-c2ccccc2)cc1.Cc1ccc(C)cc1.
What is the InChIKey of 4-phenyl-1-prop-2-enylpyridin-1-ium;1,4-xylene?
The InChIKey is WFBISTLIZPSVFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N.C8H10/c1-2-10-15-11-8-14(9-12-15)13-6-4-3-5-7-13;1-7-3-5-8(2)6-4-7/h2-9,11-12H,1,10H2;3-6H,1-2H3/q+1;.
What are the key properties of 4-phenyl-1-prop-2-enylpyridin-1-ium;1,4-xylene?
4-phenyl-1-prop-2-enylpyridin-1-ium;1,4-xylene has a molecular weight of 302.44 g/mol, XLogP of 5.13, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-1-prop-2-enylpyridin-1-ium;1,4-xylene is sourced from PubChem (CID 90739457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).