About (5E)-5-butan-2-ylidene-3-methyl-2H-1,2,4-oxadiazine
(5E)-5-butan-2-ylidene-3-methyl-2H-1,2,4-oxadiazine (PubChem CID 90739459) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is (5E)-5-butan-2-ylidene-3-methyl-2H-1,2,4-oxadiazine.
Molecular Properties
| Compound Name | (5E)-5-butan-2-ylidene-3-methyl-2H-1,2,4-oxadiazine |
| PubChem CID | 90739459 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (5E)-5-butan-2-ylidene-3-methyl-2H-1,2,4-oxadiazine |
| SMILES | CC/C(C)=C1\CONC(C)=N1 |
| InChI | InChI=1S/C8H14N2O/c1-4-6(2)8-5-11-10-7(3)9-8/h4-5H2,1-3H3,(H,9,10)/b8-6+ |
| InChIKey | NEIPJOSYWSRHNO-SOFGYWHQSA-N |
| XLogP | 1.62 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5E)-5-butan-2-ylidene-3-methyl-2H-1,2,4-oxadiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-butan-2-ylidene-3-methyl-2H-1,2,4-oxadiazine?
The IUPAC name of (5E)-5-butan-2-ylidene-3-methyl-2H-1,2,4-oxadiazine (CID 90739459) is (5E)-5-butan-2-ylidene-3-methyl-2H-1,2,4-oxadiazine.
What is the SMILES notation for (5E)-5-butan-2-ylidene-3-methyl-2H-1,2,4-oxadiazine?
The canonical SMILES for (5E)-5-butan-2-ylidene-3-methyl-2H-1,2,4-oxadiazine is CC/C(C)=C1\CONC(C)=N1.
What is the InChIKey of (5E)-5-butan-2-ylidene-3-methyl-2H-1,2,4-oxadiazine?
The InChIKey is NEIPJOSYWSRHNO-SOFGYWHQSA-N. The full InChI is InChI=1S/C8H14N2O/c1-4-6(2)8-5-11-10-7(3)9-8/h4-5H2,1-3H3,(H,9,10)/b8-6+.
What are the key properties of (5E)-5-butan-2-ylidene-3-methyl-2H-1,2,4-oxadiazine?
(5E)-5-butan-2-ylidene-3-methyl-2H-1,2,4-oxadiazine has a molecular weight of 154.21 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-butan-2-ylidene-3-methyl-2H-1,2,4-oxadiazine is sourced from PubChem (CID 90739459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).