C24H33N3O4 — CID 90739616
2-[2-hydroxy-3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol (PubChem CID 90739616) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is 2-[2-hydroxy-3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 2-[2-hydroxy-3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 90739616 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 2-[2-hydroxy-3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol |
| SMILES | CC(C)Oc1ccccc1N1CCN(CC(O)Cn2c(O)c3c(c2O)CC=CC3)CC1 |
| InChI | InChI=1S/C24H33N3O4/c1-17(2)31-22-10-6-5-9-21(22)26-13-11-25(12-14-26)15-18(28)16-27-23(29)19-7-3-4-8-20(19)24(27)30/h3-6,9-10,17-18,28-30H,7-8,11-16H2,1-2H3 |
| InChIKey | QMMQIAQGOVUBAA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|