C15H17NO7S — CID 90739807
(2S,4R)-4-(2-prop-2-enoxyphenyl)sulfonylpyrrolidine-1,2-dicarboxylic acid (PubChem CID 90739807) has the molecular formula C15H17NO7S and a molecular weight of 355.37 g/mol. Its IUPAC name is (2S,4R)-4-(2-prop-2-enoxyphenyl)sulfonylpyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2S,4R)-4-(2-prop-2-enoxyphenyl)sulfonylpyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 90739807 |
| Molecular Formula | C15H17NO7S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | (2S,4R)-4-(2-prop-2-enoxyphenyl)sulfonylpyrrolidine-1,2-dicarboxylic acid |
| SMILES | C=CCOc1ccccc1S(=O)(=O)[C@@H]1C[C@@H](C(=O)O)N(C(=O)O)C1 |
| InChI | InChI=1S/C15H17NO7S/c1-2-7-23-12-5-3-4-6-13(12)24(21,22)10-8-11(14(17)18)16(9-10)15(19)20/h2-6,10-11H,1,7-9H2,(H,17,18)(H,19,20)/t10-,11+/m1/s1 |
| InChIKey | MCIKYRWCMKAQKL-MNOVXSKESA-N |
| XLogP | 1.23 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|