C23H25N5O2 — CID 90739997
(2S)-N-[4-[[6-(4-methoxyphenyl)pyrimidin-4-yl]amino]phenyl]piperidine-2-carboxamide (PubChem CID 90739997) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is (2S)-N-[4-[[6-(4-methoxyphenyl)pyrimidin-4-yl]amino]phenyl]piperidine-2-carboxamide.
| Compound Name | (2S)-N-[4-[[6-(4-methoxyphenyl)pyrimidin-4-yl]amino]phenyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 90739997 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (2S)-N-[4-[[6-(4-methoxyphenyl)pyrimidin-4-yl]amino]phenyl]piperidine-2-carboxamide |
| SMILES | COc1ccc(-c2cc(Nc3ccc(NC(=O)[C@@H]4CCCCN4)cc3)ncn2)cc1 |
| InChI | InChI=1S/C23H25N5O2/c1-30-19-11-5-16(6-12-19)21-14-22(26-15-25-21)27-17-7-9-18(10-8-17)28-23(29)20-4-2-3-13-24-20/h5-12,14-15,20,24H,2-4,13H2,1H3,(H,28,29)(H,25,26,27)/t20-/m0/s1 |
| InChIKey | VMIKHGRQPHFJTO-FQEVSTJZSA-N |
| XLogP | 3.98 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |