C23H28N4O6S2 — CID 90740187
N-[3-(5-but-2-ynyl-1-cyclopentyl-5-methyl-2,4-dioxopiperidin-3-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide (PubChem CID 90740187) has the molecular formula C23H28N4O6S2 and a molecular weight of 520.63 g/mol. Its IUPAC name is N-[3-(5-but-2-ynyl-1-cyclopentyl-5-methyl-2,4-dioxopiperidin-3-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide.
| Compound Name | N-[3-(5-but-2-ynyl-1-cyclopentyl-5-methyl-2,4-dioxopiperidin-3-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 90740187 |
| Molecular Formula | C23H28N4O6S2 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | N-[3-(5-but-2-ynyl-1-cyclopentyl-5-methyl-2,4-dioxopiperidin-3-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
| SMILES | CC#CCC1(C)CN(C2CCCC2)C(=O)C(C2=NS(=O)(=O)c3cc(NS(C)(=O)=O)ccc3N2)C1=O |
| InChI | InChI=1S/C23H28N4O6S2/c1-4-5-12-23(2)14-27(16-8-6-7-9-16)22(29)19(20(23)28)21-24-17-11-10-15(25-34(3,30)31)13-18(17)35(32,33)26-21/h10-11,13,16,19,25H,6-9,12,14H2,1-3H3,(H,24,26) |
| InChIKey | OWLQSPQLYKNDQE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|