C13H19NO2 — CID 90740411
(2S)-2-(3,7-dimethylocta-2,4,6-trienylideneamino)propanoic acid (PubChem CID 90740411) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (2S)-2-(3,7-dimethylocta-2,4,6-trienylideneamino)propanoic acid.
| Compound Name | (2S)-2-(3,7-dimethylocta-2,4,6-trienylideneamino)propanoic acid |
|---|---|
| PubChem CID | 90740411 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (2S)-2-(3,7-dimethylocta-2,4,6-trienylideneamino)propanoic acid |
| SMILES | CC(C)=CC=CC(C)=C/C=N/[C@@H](C)C(=O)O |
| InChI | InChI=1S/C13H19NO2/c1-10(2)6-5-7-11(3)8-9-14-12(4)13(15)16/h5-9,12H,1-4H3,(H,15,16)/b7-5?,11-8?,14-9+/t12-/m0/s1 |
| InChIKey | CABBFYVZPWLSNU-FGTVHLKUSA-N |
| XLogP | 3.00 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|