About 5-(1-methoxyethenyl)-6,6-dimethyl-3-methylideneoct-4-ene-2-thione
5-(1-methoxyethenyl)-6,6-dimethyl-3-methylideneoct-4-ene-2-thione (PubChem CID 90740767) has the molecular formula C14H22OS
and a molecular weight of 238.40 g/mol. Its IUPAC name is 5-(1-methoxyethenyl)-6,6-dimethyl-3-methylideneoct-4-ene-2-thione.
Molecular Properties
| Compound Name | 5-(1-methoxyethenyl)-6,6-dimethyl-3-methylideneoct-4-ene-2-thione |
| PubChem CID | 90740767 |
| Molecular Formula | C14H22OS |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 5-(1-methoxyethenyl)-6,6-dimethyl-3-methylideneoct-4-ene-2-thione |
| SMILES | C=C(C=C(C(=C)OC)C(C)(C)CC)C(C)=S |
| InChI | InChI=1S/C14H22OS/c1-8-14(5,6)13(11(3)15-7)9-10(2)12(4)16/h9H,2-3,8H2,1,4-7H3 |
| InChIKey | IHEFNAKVCLNUHX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-methoxyethenyl)-6,6-dimethyl-3-methylideneoct-4-ene-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-methoxyethenyl)-6,6-dimethyl-3-methylideneoct-4-ene-2-thione?
The IUPAC name of 5-(1-methoxyethenyl)-6,6-dimethyl-3-methylideneoct-4-ene-2-thione (CID 90740767) is 5-(1-methoxyethenyl)-6,6-dimethyl-3-methylideneoct-4-ene-2-thione.
What is the SMILES notation for 5-(1-methoxyethenyl)-6,6-dimethyl-3-methylideneoct-4-ene-2-thione?
The canonical SMILES for 5-(1-methoxyethenyl)-6,6-dimethyl-3-methylideneoct-4-ene-2-thione is C=C(C=C(C(=C)OC)C(C)(C)CC)C(C)=S.
What is the InChIKey of 5-(1-methoxyethenyl)-6,6-dimethyl-3-methylideneoct-4-ene-2-thione?
The InChIKey is IHEFNAKVCLNUHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22OS/c1-8-14(5,6)13(11(3)15-7)9-10(2)12(4)16/h9H,2-3,8H2,1,4-7H3.
What are the key properties of 5-(1-methoxyethenyl)-6,6-dimethyl-3-methylideneoct-4-ene-2-thione?
5-(1-methoxyethenyl)-6,6-dimethyl-3-methylideneoct-4-ene-2-thione has a molecular weight of 238.40 g/mol, XLogP of 4.46, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-methoxyethenyl)-6,6-dimethyl-3-methylideneoct-4-ene-2-thione is sourced from PubChem (CID 90740767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).