C66H50 — CID 90741076
2',7'-bis[4-[2-(10b,10c-dihydropyren-1-yl)ethenyl]phenyl]spiro[cyclohexane-1,9'-fluorene] (PubChem CID 90741076) has the molecular formula C66H50 and a molecular weight of 843.13 g/mol. Its IUPAC name is 2',7'-bis[4-[2-(10b,10c-dihydropyren-1-yl)ethenyl]phenyl]spiro[cyclohexane-1,9'-fluorene].
| Compound Name | 2',7'-bis[4-[2-(10b,10c-dihydropyren-1-yl)ethenyl]phenyl]spiro[cyclohexane-1,9'-fluorene] |
|---|---|
| PubChem CID | 90741076 |
| Molecular Formula | C66H50 |
| Molecular Weight | 843.13 g/mol |
| Exact Mass | 842.39 |
| IUPAC Name | 2',7'-bis[4-[2-(10b,10c-dihydropyren-1-yl)ethenyl]phenyl]spiro[cyclohexane-1,9'-fluorene] |
| SMILES | C1=CC2=CC=C3C=CC(C=Cc4ccc(-c5ccc6c(c5)C5(CCCCC5)c5cc(-c7ccc(C=CC8=C9C=CC%10=CC=CC%11=CC=C(C=C8)C9C%10%11)cc7)ccc5-6)cc4)=C4C=CC(=C1)C2C34 |
| InChI | InChI=1S/C66H50/c1-2-38-66(39-3-1)60-40-54(44-16-10-42(11-17-44)14-20-46-22-24-52-28-26-48-6-4-8-50-30-34-56(46)64(52)62(48)50)32-36-58(60)59-37-33-55(41-61(59)66)45-18-12-43(13-19-45)15-21-47-23-25-53-29-27-49-7-5-9-51-31-35-57(47)65(53)63(49)51/h4-37,40-41,62-65H,1-3,38-39H2 |
| InChIKey | CWRTVWAZODAIOR-UHFFFAOYSA-N |
| XLogP | 16.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.13 |
| LogP ≤ 5 | 16.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |