About (1,3-dihydroxy-4,5-dihydroisoindol-2-yl)oxy-ethoxymethanethione
(1,3-dihydroxy-4,5-dihydroisoindol-2-yl)oxy-ethoxymethanethione (PubChem CID 90741488) has the molecular formula C11H13NO4S
and a molecular weight of 255.29 g/mol. Its IUPAC name is (1,3-dihydroxy-4,5-dihydroisoindol-2-yl)oxy-ethoxymethanethione.
Molecular Properties
| Compound Name | (1,3-dihydroxy-4,5-dihydroisoindol-2-yl)oxy-ethoxymethanethione |
| PubChem CID | 90741488 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | (1,3-dihydroxy-4,5-dihydroisoindol-2-yl)oxy-ethoxymethanethione |
| SMILES | CCOC(=S)On1c(O)c2c(c1O)CCC=C2 |
| InChI | InChI=1S/C11H13NO4S/c1-2-15-11(17)16-12-9(13)7-5-3-4-6-8(7)10(12)14/h3,5,13-14H,2,4,6H2,1H3 |
| InChIKey | SAPFLMNIKIVUCP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (1,3-dihydroxy-4,5-dihydroisoindol-2-yl)oxy-ethoxymethanethione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dihydroxy-4,5-dihydroisoindol-2-yl)oxy-ethoxymethanethione?
The IUPAC name of (1,3-dihydroxy-4,5-dihydroisoindol-2-yl)oxy-ethoxymethanethione (CID 90741488) is (1,3-dihydroxy-4,5-dihydroisoindol-2-yl)oxy-ethoxymethanethione.
What is the SMILES notation for (1,3-dihydroxy-4,5-dihydroisoindol-2-yl)oxy-ethoxymethanethione?
The canonical SMILES for (1,3-dihydroxy-4,5-dihydroisoindol-2-yl)oxy-ethoxymethanethione is CCOC(=S)On1c(O)c2c(c1O)CCC=C2.
What is the InChIKey of (1,3-dihydroxy-4,5-dihydroisoindol-2-yl)oxy-ethoxymethanethione?
The InChIKey is SAPFLMNIKIVUCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4S/c1-2-15-11(17)16-12-9(13)7-5-3-4-6-8(7)10(12)14/h3,5,13-14H,2,4,6H2,1H3.
What are the key properties of (1,3-dihydroxy-4,5-dihydroisoindol-2-yl)oxy-ethoxymethanethione?
(1,3-dihydroxy-4,5-dihydroisoindol-2-yl)oxy-ethoxymethanethione has a molecular weight of 255.29 g/mol, XLogP of 1.61, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dihydroxy-4,5-dihydroisoindol-2-yl)oxy-ethoxymethanethione is sourced from PubChem (CID 90741488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).