About 3-but-2-ynoxy-5-ethyl-1,2,4-thiadiazole
3-but-2-ynoxy-5-ethyl-1,2,4-thiadiazole (PubChem CID 90741617) has the molecular formula C8H10N2OS
and a molecular weight of 182.25 g/mol. Its IUPAC name is 3-but-2-ynoxy-5-ethyl-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 3-but-2-ynoxy-5-ethyl-1,2,4-thiadiazole |
| PubChem CID | 90741617 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 3-but-2-ynoxy-5-ethyl-1,2,4-thiadiazole |
| SMILES | CC#CCOc1nsc(CC)n1 |
| InChI | InChI=1S/C8H10N2OS/c1-3-5-6-11-8-9-7(4-2)12-10-8/h4,6H2,1-2H3 |
| InChIKey | BWXOSZGEWBAJBA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-but-2-ynoxy-5-ethyl-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-2-ynoxy-5-ethyl-1,2,4-thiadiazole?
The IUPAC name of 3-but-2-ynoxy-5-ethyl-1,2,4-thiadiazole (CID 90741617) is 3-but-2-ynoxy-5-ethyl-1,2,4-thiadiazole.
What is the SMILES notation for 3-but-2-ynoxy-5-ethyl-1,2,4-thiadiazole?
The canonical SMILES for 3-but-2-ynoxy-5-ethyl-1,2,4-thiadiazole is CC#CCOc1nsc(CC)n1.
What is the InChIKey of 3-but-2-ynoxy-5-ethyl-1,2,4-thiadiazole?
The InChIKey is BWXOSZGEWBAJBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2OS/c1-3-5-6-11-8-9-7(4-2)12-10-8/h4,6H2,1-2H3.
What are the key properties of 3-but-2-ynoxy-5-ethyl-1,2,4-thiadiazole?
3-but-2-ynoxy-5-ethyl-1,2,4-thiadiazole has a molecular weight of 182.25 g/mol, XLogP of 1.50, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-2-ynoxy-5-ethyl-1,2,4-thiadiazole is sourced from PubChem (CID 90741617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).