C27H29ClN4O5S — CID 90741815
2-[[5-[4-(6-chlorohepta-1,3,5-trien-2-yl)piperazin-1-yl]sulfonyl-2,3-dihydroindole-1-carbonyl]amino]benzoic acid (PubChem CID 90741815) has the molecular formula C27H29ClN4O5S and a molecular weight of 557.07 g/mol. Its IUPAC name is 2-[[5-[4-(6-chlorohepta-1,3,5-trien-2-yl)piperazin-1-yl]sulfonyl-2,3-dihydroindole-1-carbonyl]amino]benzoic acid.
| Compound Name | 2-[[5-[4-(6-chlorohepta-1,3,5-trien-2-yl)piperazin-1-yl]sulfonyl-2,3-dihydroindole-1-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 90741815 |
| Molecular Formula | C27H29ClN4O5S |
| Molecular Weight | 557.07 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | 2-[[5-[4-(6-chlorohepta-1,3,5-trien-2-yl)piperazin-1-yl]sulfonyl-2,3-dihydroindole-1-carbonyl]amino]benzoic acid |
| SMILES | C=C(C=CC=C(C)Cl)N1CCN(S(=O)(=O)c2ccc3c(c2)CCN3C(=O)Nc2ccccc2C(=O)O)CC1 |
| InChI | InChI=1S/C27H29ClN4O5S/c1-19(28)6-5-7-20(2)30-14-16-31(17-15-30)38(36,37)22-10-11-25-21(18-22)12-13-32(25)27(35)29-24-9-4-3-8-23(24)26(33)34/h3-11,18H,2,12-17H2,1H3,(H,29,35)(H,33,34) |
| InChIKey | YIJAZFDXSXLJAN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.07 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|