C16H18N6O2S — CID 90741884
aminothiourea;methyl 2-(1-methylpyrazol-4-yl)quinoline-4-carboxylate (PubChem CID 90741884) has the molecular formula C16H18N6O2S and a molecular weight of 358.43 g/mol. Its IUPAC name is aminothiourea;methyl 2-(1-methylpyrazol-4-yl)quinoline-4-carboxylate.
| Compound Name | aminothiourea;methyl 2-(1-methylpyrazol-4-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 90741884 |
| Molecular Formula | C16H18N6O2S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | aminothiourea;methyl 2-(1-methylpyrazol-4-yl)quinoline-4-carboxylate |
| SMILES | COC(=O)c1cc(-c2cnn(C)c2)nc2ccccc12.NNC(N)=S |
| InChI | InChI=1S/C15H13N3O2.CH5N3S/c1-18-9-10(8-16-18)14-7-12(15(19)20-2)11-5-3-4-6-13(11)17-14;2-1(5)4-3/h3-9H,1-2H3;3H2,(H3,2,4,5) |
| InChIKey | CSWZBSXJSMTMAU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|