C30H48ClN5O3 — CID 90741886
N-[(3S)-1-[[(2R)-3-(4-chlorophenyl)-2-[2-(diethylamino)ethylamino]propanoyl]amino]pyrrolidin-3-yl]-N-cyclohexyl-2,2-dimethyl-3-oxopropanamide (PubChem CID 90741886) has the molecular formula C30H48ClN5O3 and a molecular weight of 562.20 g/mol. Its IUPAC name is N-[(3S)-1-[[(2R)-3-(4-chlorophenyl)-2-[2-(diethylamino)ethylamino]propanoyl]amino]pyrrolidin-3-yl]-N-cyclohexyl-2,2-dimethyl-3-oxopropanamide.
| Compound Name | N-[(3S)-1-[[(2R)-3-(4-chlorophenyl)-2-[2-(diethylamino)ethylamino]propanoyl]amino]pyrrolidin-3-yl]-N-cyclohexyl-2,2-dimethyl-3-oxopropanamide |
|---|---|
| PubChem CID | 90741886 |
| Molecular Formula | C30H48ClN5O3 |
| Molecular Weight | 562.20 g/mol |
| Exact Mass | 561.34 |
| IUPAC Name | N-[(3S)-1-[[(2R)-3-(4-chlorophenyl)-2-[2-(diethylamino)ethylamino]propanoyl]amino]pyrrolidin-3-yl]-N-cyclohexyl-2,2-dimethyl-3-oxopropanamide |
| SMILES | CCN(CC)CCN[C@H](Cc1ccc(Cl)cc1)C(=O)NN1CC[C@H](N(C(=O)C(C)(C)C=O)C2CCCCC2)C1 |
| InChI | InChI=1S/C30H48ClN5O3/c1-5-34(6-2)19-17-32-27(20-23-12-14-24(31)15-13-23)28(38)33-35-18-16-26(21-35)36(25-10-8-7-9-11-25)29(39)30(3,4)22-37/h12-15,22,25-27,32H,5-11,16-21H2,1-4H3,(H,33,38)/t26-,27+/m0/s1 |
| InChIKey | QUSVPSBOUBPIKI-RRPNLBNLSA-N |
| XLogP | 3.67 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.20 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|