About hept-2-en-3-ylphosphane
hept-2-en-3-ylphosphane (PubChem CID 90741921) has the molecular formula C7H15P
and a molecular weight of 130.17 g/mol. Its IUPAC name is hept-2-en-3-ylphosphane.
Molecular Properties
| Compound Name | hept-2-en-3-ylphosphane |
| PubChem CID | 90741921 |
| Molecular Formula | C7H15P |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | hept-2-en-3-ylphosphane |
| SMILES | CC=C(P)CCCC |
| InChI | InChI=1S/C7H15P/c1-3-5-6-7(8)4-2/h4H,3,5-6,8H2,1-2H3 |
| InChIKey | LCBHYTNMAPKEGY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hept-2-en-3-ylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-2-en-3-ylphosphane?
The IUPAC name of hept-2-en-3-ylphosphane (CID 90741921) is hept-2-en-3-ylphosphane.
What is the SMILES notation for hept-2-en-3-ylphosphane?
The canonical SMILES for hept-2-en-3-ylphosphane is CC=C(P)CCCC.
What is the InChIKey of hept-2-en-3-ylphosphane?
The InChIKey is LCBHYTNMAPKEGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15P/c1-3-5-6-7(8)4-2/h4H,3,5-6,8H2,1-2H3.
What are the key properties of hept-2-en-3-ylphosphane?
hept-2-en-3-ylphosphane has a molecular weight of 130.17 g/mol, XLogP of 2.96, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hept-2-en-3-ylphosphane is sourced from PubChem (CID 90741921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).