C36H22F8 — CID 90741952
1,2,3,4,5,6,7,8-octafluoro-9,10-bis[2-(2,4,6-trimethylphenyl)ethynyl]anthracene (PubChem CID 90741952) has the molecular formula C36H22F8 and a molecular weight of 606.56 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octafluoro-9,10-bis[2-(2,4,6-trimethylphenyl)ethynyl]anthracene.
| Compound Name | 1,2,3,4,5,6,7,8-octafluoro-9,10-bis[2-(2,4,6-trimethylphenyl)ethynyl]anthracene |
|---|---|
| PubChem CID | 90741952 |
| Molecular Formula | C36H22F8 |
| Molecular Weight | 606.56 g/mol |
| Exact Mass | 606.16 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octafluoro-9,10-bis[2-(2,4,6-trimethylphenyl)ethynyl]anthracene |
| SMILES | Cc1cc(C)c(C#Cc2c3c(F)c(F)c(F)c(F)c3c(C#Cc3c(C)cc(C)cc3C)c3c(F)c(F)c(F)c(F)c23)c(C)c1 |
| InChI | InChI=1S/C36H22F8/c1-15-11-17(3)21(18(4)12-15)7-9-23-25-27(31(39)35(43)33(41)29(25)37)24(10-8-22-19(5)13-16(2)14-20(22)6)28-26(23)30(38)34(42)36(44)32(28)40/h11-14H,1-6H3 |
| InChIKey | YYIVDNHHWCQYCH-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.56 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|