2-bromo-5,6-dimethoxypyrimidine-4-carboxylic acid

C7H7BrN2O4 — CID 90742154

IUPAC2-bromo-5,6-dimethoxypyrimidine-4-carboxylic acid
SMILESCOc1nc(Br)nc(C(=O)O)c1OC
InChIInChI=1S/C7H7BrN2O4/c1-13-4-3(6(11)12)9-7(8)10-5(4)14-2/h1-2H3,(H,11,12)
InChIKeyDGYNEONFMLMTGV-UHFFFAOYSA-N
MW263.05 g/mol
LogP0.95
Rot. Bonds3

About 2-bromo-5,6-dimethoxypyrimidine-4-carboxylic acid

2-bromo-5,6-dimethoxypyrimidine-4-carboxylic acid (PubChem CID 90742154) has the molecular formula C7H7BrN2O4 and a molecular weight of 263.05 g/mol. Its IUPAC name is 2-bromo-5,6-dimethoxypyrimidine-4-carboxylic acid.

Molecular Properties

Compound Name2-bromo-5,6-dimethoxypyrimidine-4-carboxylic acid
PubChem CID90742154
Molecular FormulaC7H7BrN2O4
Molecular Weight263.05 g/mol
Exact Mass261.96
IUPAC Name2-bromo-5,6-dimethoxypyrimidine-4-carboxylic acid
SMILESCOc1nc(Br)nc(C(=O)O)c1OC
InChIInChI=1S/C7H7BrN2O4/c1-13-4-3(6(11)12)9-7(8)10-5(4)14-2/h1-2H3,(H,11,12)
InChIKeyDGYNEONFMLMTGV-UHFFFAOYSA-N
XLogP0.95
TPSA81.54 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.05
LogP ≤ 50.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-bromo-5,6-dimethoxypyrimidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromo-5,6-dimethoxypyrimidine-4-carboxylic acid?
The IUPAC name of 2-bromo-5,6-dimethoxypyrimidine-4-carboxylic acid (CID 90742154) is 2-bromo-5,6-dimethoxypyrimidine-4-carboxylic acid.
What is the SMILES notation for 2-bromo-5,6-dimethoxypyrimidine-4-carboxylic acid?
The canonical SMILES for 2-bromo-5,6-dimethoxypyrimidine-4-carboxylic acid is COc1nc(Br)nc(C(=O)O)c1OC.
What is the InChIKey of 2-bromo-5,6-dimethoxypyrimidine-4-carboxylic acid?
The InChIKey is DGYNEONFMLMTGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrN2O4/c1-13-4-3(6(11)12)9-7(8)10-5(4)14-2/h1-2H3,(H,11,12).
What are the key properties of 2-bromo-5,6-dimethoxypyrimidine-4-carboxylic acid?
2-bromo-5,6-dimethoxypyrimidine-4-carboxylic acid has a molecular weight of 263.05 g/mol, XLogP of 0.95, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5,6-dimethoxypyrimidine-4-carboxylic acid is sourced from PubChem (CID 90742154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).