About 1-(2,4-dioxopyrimidin-1-yl)pyrimidine-2,4-dione
1-(2,4-dioxopyrimidin-1-yl)pyrimidine-2,4-dione (PubChem CID 90742304) has the molecular formula C8H6N4O4
and a molecular weight of 222.16 g/mol. Its IUPAC name is 1-(2,4-dioxopyrimidin-1-yl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-(2,4-dioxopyrimidin-1-yl)pyrimidine-2,4-dione |
| PubChem CID | 90742304 |
| Molecular Formula | C8H6N4O4 |
| Molecular Weight | 222.16 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 1-(2,4-dioxopyrimidin-1-yl)pyrimidine-2,4-dione |
| SMILES | O=c1ccn(-n2ccc(=O)[nH]c2=O)c(=O)[nH]1 |
| InChI | InChI=1S/C8H6N4O4/c13-5-1-3-11(7(15)9-5)12-4-2-6(14)10-8(12)16/h1-4H,(H,9,13,15)(H,10,14,16) |
| InChIKey | DPDYWKYIPDKLPM-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.16 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2,4-dioxopyrimidin-1-yl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dioxopyrimidin-1-yl)pyrimidine-2,4-dione?
The IUPAC name of 1-(2,4-dioxopyrimidin-1-yl)pyrimidine-2,4-dione (CID 90742304) is 1-(2,4-dioxopyrimidin-1-yl)pyrimidine-2,4-dione.
What is the SMILES notation for 1-(2,4-dioxopyrimidin-1-yl)pyrimidine-2,4-dione?
The canonical SMILES for 1-(2,4-dioxopyrimidin-1-yl)pyrimidine-2,4-dione is O=c1ccn(-n2ccc(=O)[nH]c2=O)c(=O)[nH]1.
What is the InChIKey of 1-(2,4-dioxopyrimidin-1-yl)pyrimidine-2,4-dione?
The InChIKey is DPDYWKYIPDKLPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4O4/c13-5-1-3-11(7(15)9-5)12-4-2-6(14)10-8(12)16/h1-4H,(H,9,13,15)(H,10,14,16).
What are the key properties of 1-(2,4-dioxopyrimidin-1-yl)pyrimidine-2,4-dione?
1-(2,4-dioxopyrimidin-1-yl)pyrimidine-2,4-dione has a molecular weight of 222.16 g/mol, XLogP of -2.30, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dioxopyrimidin-1-yl)pyrimidine-2,4-dione is sourced from PubChem (CID 90742304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).