C41H44F10O6 — CID 90742784
2,2,3,3,3-pentafluoropropyl 2-[[6-(2-methylbutan-2-yl)naphthalen-2-yl]methoxy]acetate;2,2,3,3,3-pentafluoropropyl 2-[6-(2-methylbutan-2-yl)naphthalen-2-yl]oxyacetate (PubChem CID 90742784) has the molecular formula C41H44F10O6 and a molecular weight of 822.78 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 2-[[6-(2-methylbutan-2-yl)naphthalen-2-yl]methoxy]acetate;2,2,3,3,3-pentafluoropropyl 2-[6-(2-methylbutan-2-yl)naphthalen-2-yl]oxyacetate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 2-[[6-(2-methylbutan-2-yl)naphthalen-2-yl]methoxy]acetate;2,2,3,3,3-pentafluoropropyl 2-[6-(2-methylbutan-2-yl)naphthalen-2-yl]oxyacetate |
|---|---|
| PubChem CID | 90742784 |
| Molecular Formula | C41H44F10O6 |
| Molecular Weight | 822.78 g/mol |
| Exact Mass | 822.30 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 2-[[6-(2-methylbutan-2-yl)naphthalen-2-yl]methoxy]acetate;2,2,3,3,3-pentafluoropropyl 2-[6-(2-methylbutan-2-yl)naphthalen-2-yl]oxyacetate |
| SMILES | CCC(C)(C)c1ccc2cc(COCC(=O)OCC(F)(F)C(F)(F)F)ccc2c1.CCC(C)(C)c1ccc2cc(OCC(=O)OCC(F)(F)C(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C21H23F5O3.C20H21F5O3/c1-4-19(2,3)17-8-7-15-9-14(5-6-16(15)10-17)11-28-12-18(27)29-13-20(22,23)21(24,25)26;1-4-18(2,3)15-7-5-14-10-16(8-6-13(14)9-15)27-11-17(26)28-12-19(21,22)20(23,24)25/h5-10H,4,11-13H2,1-3H3;5-10H,4,11-12H2,1-3H3 |
| InChIKey | SQBIAGIAEKBCDM-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.78 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|