About 3,4-dichloro-N-[(2-cyano-2-phenylethylidene)amino]-N-methyl-1,2-thiazole-5-carboxamide
3,4-dichloro-N-[(2-cyano-2-phenylethylidene)amino]-N-methyl-1,2-thiazole-5-carboxamide (PubChem CID 90742892) has the molecular formula C14H10Cl2N4OS
and a molecular weight of 353.23 g/mol. Its IUPAC name is 3,4-dichloro-N-[(2-cyano-2-phenylethylidene)amino]-N-methyl-1,2-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 3,4-dichloro-N-[(2-cyano-2-phenylethylidene)amino]-N-methyl-1,2-thiazole-5-carboxamide |
| PubChem CID | 90742892 |
| Molecular Formula | C14H10Cl2N4OS |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 3,4-dichloro-N-[(2-cyano-2-phenylethylidene)amino]-N-methyl-1,2-thiazole-5-carboxamide |
| SMILES | CN(N=CC(C#N)c1ccccc1)C(=O)c1snc(Cl)c1Cl |
| InChI | InChI=1S/C14H10Cl2N4OS/c1-20(14(21)12-11(15)13(16)19-22-12)18-8-10(7-17)9-5-3-2-4-6-9/h2-6,8,10H,1H3 |
| InChIKey | MQEZULLDMSHTLM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dichloro-N-[(2-cyano-2-phenylethylidene)amino]-N-methyl-1,2-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dichloro-N-[(2-cyano-2-phenylethylidene)amino]-N-methyl-1,2-thiazole-5-carboxamide?
The IUPAC name of 3,4-dichloro-N-[(2-cyano-2-phenylethylidene)amino]-N-methyl-1,2-thiazole-5-carboxamide (CID 90742892) is 3,4-dichloro-N-[(2-cyano-2-phenylethylidene)amino]-N-methyl-1,2-thiazole-5-carboxamide.
What is the SMILES notation for 3,4-dichloro-N-[(2-cyano-2-phenylethylidene)amino]-N-methyl-1,2-thiazole-5-carboxamide?
The canonical SMILES for 3,4-dichloro-N-[(2-cyano-2-phenylethylidene)amino]-N-methyl-1,2-thiazole-5-carboxamide is CN(N=CC(C#N)c1ccccc1)C(=O)c1snc(Cl)c1Cl.
What is the InChIKey of 3,4-dichloro-N-[(2-cyano-2-phenylethylidene)amino]-N-methyl-1,2-thiazole-5-carboxamide?
The InChIKey is MQEZULLDMSHTLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2N4OS/c1-20(14(21)12-11(15)13(16)19-22-12)18-8-10(7-17)9-5-3-2-4-6-9/h2-6,8,10H,1H3.
What are the key properties of 3,4-dichloro-N-[(2-cyano-2-phenylethylidene)amino]-N-methyl-1,2-thiazole-5-carboxamide?
3,4-dichloro-N-[(2-cyano-2-phenylethylidene)amino]-N-methyl-1,2-thiazole-5-carboxamide has a molecular weight of 353.23 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichloro-N-[(2-cyano-2-phenylethylidene)amino]-N-methyl-1,2-thiazole-5-carboxamide is sourced from PubChem (CID 90742892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).