C33H39N3O7 — CID 90743062
(2R,4S,5S)-4,5-dihydroxy-2-methoxy-3-oxo-N-[2-oxo-1-[(4-phenylphenyl)methyl]azepan-3-yl]-6-(phenylmethoxyamino)hexanamide (PubChem CID 90743062) has the molecular formula C33H39N3O7 and a molecular weight of 589.69 g/mol. Its IUPAC name is (2R,4S,5S)-4,5-dihydroxy-2-methoxy-3-oxo-N-[2-oxo-1-[(4-phenylphenyl)methyl]azepan-3-yl]-6-(phenylmethoxyamino)hexanamide.
| Compound Name | (2R,4S,5S)-4,5-dihydroxy-2-methoxy-3-oxo-N-[2-oxo-1-[(4-phenylphenyl)methyl]azepan-3-yl]-6-(phenylmethoxyamino)hexanamide |
|---|---|
| PubChem CID | 90743062 |
| Molecular Formula | C33H39N3O7 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | (2R,4S,5S)-4,5-dihydroxy-2-methoxy-3-oxo-N-[2-oxo-1-[(4-phenylphenyl)methyl]azepan-3-yl]-6-(phenylmethoxyamino)hexanamide |
| SMILES | CO[C@@H](C(=O)NC1CCCCN(Cc2ccc(-c3ccccc3)cc2)C1=O)C(=O)[C@@H](O)[C@@H](O)CNOCc1ccccc1 |
| InChI | InChI=1S/C33H39N3O7/c1-42-31(30(39)29(38)28(37)20-34-43-22-24-10-4-2-5-11-24)32(40)35-27-14-8-9-19-36(33(27)41)21-23-15-17-26(18-16-23)25-12-6-3-7-13-25/h2-7,10-13,15-18,27-29,31,34,37-38H,8-9,14,19-22H2,1H3,(H,35,40)/t27?,28-,29-,31+/m0/s1 |
| InChIKey | ZXMORXPVSDMPQU-LKBHKVAASA-N |
| XLogP | 2.38 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|