C21H27NO — CID 90743493
7-methoxy-3-(4-phenylbutyl)-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 90743493) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is 7-methoxy-3-(4-phenylbutyl)-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 7-methoxy-3-(4-phenylbutyl)-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 90743493 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 7-methoxy-3-(4-phenylbutyl)-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | COc1ccc2c(c1)CCN(CCCCc1ccccc1)CC2 |
| InChI | InChI=1S/C21H27NO/c1-23-21-11-10-19-12-15-22(16-13-20(19)17-21)14-6-5-9-18-7-3-2-4-8-18/h2-4,7-8,10-11,17H,5-6,9,12-16H2,1H3 |
| InChIKey | GQIMMLJXHGNXCX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|