C26H30BN3O3 — CID 90743791
CID 90743791 (PubChem CID 90743791) has the molecular formula C26H30BN3O3 and a molecular weight of 443.36 g/mol.
| Compound Name | CID 90743791 |
|---|---|
| PubChem CID | 90743791 |
| Molecular Formula | C26H30BN3O3 |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2cc(-c3cnc(C4CCCCN4C(=O)C(CC(=O)OC)C(C)C)[nH]3)ccc2c1 |
| InChI | InChI=1S/C26H30BN3O3/c1-16(2)21(14-24(31)33-3)26(32)30-11-5-4-6-23(30)25-28-15-22(29-25)19-8-7-18-13-20(27)10-9-17(18)12-19/h7-10,12-13,15-16,21,23H,4-6,11,14H2,1-3H3,(H,28,29) |
| InChIKey | AHEWANCFFCMFHR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|