About 3-imino-5-methyl-2-(2-methylpropyl)cyclohepta-1,6-diene-1-carboxylic acid
3-imino-5-methyl-2-(2-methylpropyl)cyclohepta-1,6-diene-1-carboxylic acid (PubChem CID 90743816) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-imino-5-methyl-2-(2-methylpropyl)cyclohepta-1,6-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-imino-5-methyl-2-(2-methylpropyl)cyclohepta-1,6-diene-1-carboxylic acid |
| PubChem CID | 90743816 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 3-imino-5-methyl-2-(2-methylpropyl)cyclohepta-1,6-diene-1-carboxylic acid |
| SMILES | [H]/N=C1\CC(C)C=CC(C(=O)O)=C1CC(C)C |
| InChI | InChI=1S/C13H19NO2/c1-8(2)6-11-10(13(15)16)5-4-9(3)7-12(11)14/h4-5,8-9,14H,6-7H2,1-3H3,(H,15,16)/b14-12+ |
| InChIKey | SQMXPCGRLRBSNQ-WYMLVPIESA-N |
| XLogP | 3.03 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-5-methyl-2-(2-methylpropyl)cyclohepta-1,6-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-5-methyl-2-(2-methylpropyl)cyclohepta-1,6-diene-1-carboxylic acid?
The IUPAC name of 3-imino-5-methyl-2-(2-methylpropyl)cyclohepta-1,6-diene-1-carboxylic acid (CID 90743816) is 3-imino-5-methyl-2-(2-methylpropyl)cyclohepta-1,6-diene-1-carboxylic acid.
What is the SMILES notation for 3-imino-5-methyl-2-(2-methylpropyl)cyclohepta-1,6-diene-1-carboxylic acid?
The canonical SMILES for 3-imino-5-methyl-2-(2-methylpropyl)cyclohepta-1,6-diene-1-carboxylic acid is [H]/N=C1\CC(C)C=CC(C(=O)O)=C1CC(C)C.
What is the InChIKey of 3-imino-5-methyl-2-(2-methylpropyl)cyclohepta-1,6-diene-1-carboxylic acid?
The InChIKey is SQMXPCGRLRBSNQ-WYMLVPIESA-N. The full InChI is InChI=1S/C13H19NO2/c1-8(2)6-11-10(13(15)16)5-4-9(3)7-12(11)14/h4-5,8-9,14H,6-7H2,1-3H3,(H,15,16)/b14-12+.
What are the key properties of 3-imino-5-methyl-2-(2-methylpropyl)cyclohepta-1,6-diene-1-carboxylic acid?
3-imino-5-methyl-2-(2-methylpropyl)cyclohepta-1,6-diene-1-carboxylic acid has a molecular weight of 221.30 g/mol, XLogP of 3.03, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-5-methyl-2-(2-methylpropyl)cyclohepta-1,6-diene-1-carboxylic acid is sourced from PubChem (CID 90743816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).