C24H17NO7 — CID 90744160
10,10,16-trimethyl-6-(4-nitrophenyl)-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1,5,7,11,13,16-hexaene-4,18-dione (PubChem CID 90744160) has the molecular formula C24H17NO7 and a molecular weight of 431.40 g/mol. Its IUPAC name is 10,10,16-trimethyl-6-(4-nitrophenyl)-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1,5,7,11,13,16-hexaene-4,18-dione.
| Compound Name | 10,10,16-trimethyl-6-(4-nitrophenyl)-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1,5,7,11,13,16-hexaene-4,18-dione |
|---|---|
| PubChem CID | 90744160 |
| Molecular Formula | C24H17NO7 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 10,10,16-trimethyl-6-(4-nitrophenyl)-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1,5,7,11,13,16-hexaene-4,18-dione |
| SMILES | Cc1cc(=O)c2c(o1)c1c(c3c(-c4ccc([N+](=O)[O-])cc4)cc(=O)oc32)OC(C)(C)C=C1 |
| InChI | InChI=1S/C24H17NO7/c1-12-10-17(26)20-21(30-12)15-8-9-24(2,3)32-22(15)19-16(11-18(27)31-23(19)20)13-4-6-14(7-5-13)25(28)29/h4-11H,1-3H3 |
| InChIKey | HARSCIHTYPHELT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 112.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|