C23H24N4O2 — CID 90744300
6-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-(4-methoxyphenyl)-2,3,6-triazatricyclo[6.3.1.04,12]dodeca-1(11),4,8(12),9-tetraen-7-one (PubChem CID 90744300) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 6-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-(4-methoxyphenyl)-2,3,6-triazatricyclo[6.3.1.04,12]dodeca-1(11),4,8(12),9-tetraen-7-one.
| Compound Name | 6-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-(4-methoxyphenyl)-2,3,6-triazatricyclo[6.3.1.04,12]dodeca-1(11),4,8(12),9-tetraen-7-one |
|---|---|
| PubChem CID | 90744300 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 6-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-(4-methoxyphenyl)-2,3,6-triazatricyclo[6.3.1.04,12]dodeca-1(11),4,8(12),9-tetraen-7-one |
| SMILES | COc1ccc(N2Nc3cn([C@H]4CN5CCC4CC5)c(=O)c4cccc2c34)cc1 |
| InChI | InChI=1S/C23H24N4O2/c1-29-17-7-5-16(6-8-17)27-20-4-2-3-18-22(20)19(24-27)13-26(23(18)28)21-14-25-11-9-15(21)10-12-25/h2-8,13,15,21,24H,9-12,14H2,1H3/t21-/m0/s1 |
| InChIKey | GTOVOFHFJNASEM-NRFANRHFSA-N |
| XLogP | 3.76 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |