C15H18Br2N4O4S — CID 90744428
[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl-ethylcarbamic acid (PubChem CID 90744428) has the molecular formula C15H18Br2N4O4S and a molecular weight of 510.21 g/mol. Its IUPAC name is [(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl-ethylcarbamic acid.
| Compound Name | [(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl-ethylcarbamic acid |
|---|---|
| PubChem CID | 90744428 |
| Molecular Formula | C15H18Br2N4O4S |
| Molecular Weight | 510.21 g/mol |
| Exact Mass | 507.94 |
| IUPAC Name | [(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl-ethylcarbamic acid |
| SMILES | CCN(C[C@H]1C[C@@H](NS(=O)(=O)c2cc(Br)ccc2Br)CN1C#N)C(=O)O |
| InChI | InChI=1S/C15H18Br2N4O4S/c1-2-20(15(22)23)8-12-6-11(7-21(12)9-18)19-26(24,25)14-5-10(16)3-4-13(14)17/h3-5,11-12,19H,2,6-8H2,1H3,(H,22,23)/t11-,12-/m1/s1 |
| InChIKey | MDIUHWRNXGYMTB-VXGBXAGGSA-N |
| XLogP | 2.41 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|