C40H37ClO2 — CID 90744590
ethyl 4-[2-[4-(4-tert-butylphenyl)phenyl]-2-[4-(4-chlorophenyl)-3-methylphenyl]ethenyl]benzoate (PubChem CID 90744590) has the molecular formula C40H37ClO2 and a molecular weight of 585.19 g/mol. Its IUPAC name is ethyl 4-[2-[4-(4-tert-butylphenyl)phenyl]-2-[4-(4-chlorophenyl)-3-methylphenyl]ethenyl]benzoate.
| Compound Name | ethyl 4-[2-[4-(4-tert-butylphenyl)phenyl]-2-[4-(4-chlorophenyl)-3-methylphenyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 90744590 |
| Molecular Formula | C40H37ClO2 |
| Molecular Weight | 585.19 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | ethyl 4-[2-[4-(4-tert-butylphenyl)phenyl]-2-[4-(4-chlorophenyl)-3-methylphenyl]ethenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C=C(c2ccc(-c3ccc(C(C)(C)C)cc3)cc2)c2ccc(-c3ccc(Cl)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C40H37ClO2/c1-6-43-39(42)33-9-7-28(8-10-33)26-38(34-19-24-37(27(2)25-34)31-17-22-36(41)23-18-31)32-13-11-29(12-14-32)30-15-20-35(21-16-30)40(3,4)5/h7-26H,6H2,1-5H3 |
| InChIKey | KLDAGEZUIRNWLC-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.19 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|