About bis(2-methyl-1,3-thiazol-4-yl)methanone
bis(2-methyl-1,3-thiazol-4-yl)methanone (PubChem CID 90744701) has the molecular formula C9H8N2OS2
and a molecular weight of 224.31 g/mol. Its IUPAC name is bis(2-methyl-1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | bis(2-methyl-1,3-thiazol-4-yl)methanone |
| PubChem CID | 90744701 |
| Molecular Formula | C9H8N2OS2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | bis(2-methyl-1,3-thiazol-4-yl)methanone |
| SMILES | Cc1nc(C(=O)c2csc(C)n2)cs1 |
| InChI | InChI=1S/C9H8N2OS2/c1-5-10-7(3-13-5)9(12)8-4-14-6(2)11-8/h3-4H,1-2H3 |
| InChIKey | PDJMFHXFBQTOFN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(2-methyl-1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methyl-1,3-thiazol-4-yl)methanone?
The IUPAC name of bis(2-methyl-1,3-thiazol-4-yl)methanone (CID 90744701) is bis(2-methyl-1,3-thiazol-4-yl)methanone.
What is the SMILES notation for bis(2-methyl-1,3-thiazol-4-yl)methanone?
The canonical SMILES for bis(2-methyl-1,3-thiazol-4-yl)methanone is Cc1nc(C(=O)c2csc(C)n2)cs1.
What is the InChIKey of bis(2-methyl-1,3-thiazol-4-yl)methanone?
The InChIKey is PDJMFHXFBQTOFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2OS2/c1-5-10-7(3-13-5)9(12)8-4-14-6(2)11-8/h3-4H,1-2H3.
What are the key properties of bis(2-methyl-1,3-thiazol-4-yl)methanone?
bis(2-methyl-1,3-thiazol-4-yl)methanone has a molecular weight of 224.31 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methyl-1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 90744701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).