About 5,5-dimethylcyclopenta-1,3-diene;ethane
5,5-dimethylcyclopenta-1,3-diene;ethane (PubChem CID 90745193) has the molecular formula C9H16
and a molecular weight of 124.23 g/mol. Its IUPAC name is 5,5-dimethylcyclopenta-1,3-diene;ethane.
Molecular Properties
| Compound Name | 5,5-dimethylcyclopenta-1,3-diene;ethane |
| PubChem CID | 90745193 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | 5,5-dimethylcyclopenta-1,3-diene;ethane |
| SMILES | CC.CC1(C)C=CC=C1 |
| InChI | InChI=1S/C7H10.C2H6/c1-7(2)5-3-4-6-7;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | ZURWPDFBQJIUER-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5,5-dimethylcyclopenta-1,3-diene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethylcyclopenta-1,3-diene;ethane?
The IUPAC name of 5,5-dimethylcyclopenta-1,3-diene;ethane (CID 90745193) is 5,5-dimethylcyclopenta-1,3-diene;ethane.
What is the SMILES notation for 5,5-dimethylcyclopenta-1,3-diene;ethane?
The canonical SMILES for 5,5-dimethylcyclopenta-1,3-diene;ethane is CC.CC1(C)C=CC=C1.
What is the InChIKey of 5,5-dimethylcyclopenta-1,3-diene;ethane?
The InChIKey is ZURWPDFBQJIUER-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10.C2H6/c1-7(2)5-3-4-6-7;1-2/h3-6H,1-2H3;1-2H3.
What are the key properties of 5,5-dimethylcyclopenta-1,3-diene;ethane?
5,5-dimethylcyclopenta-1,3-diene;ethane has a molecular weight of 124.23 g/mol, XLogP of 3.16, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethylcyclopenta-1,3-diene;ethane is sourced from PubChem (CID 90745193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).