About hydroxylamine;methanesulfonyl chloride;5-methyl-1H-pyrazol-3-amine
hydroxylamine;methanesulfonyl chloride;5-methyl-1H-pyrazol-3-amine (PubChem CID 90745357) has the molecular formula C5H13ClN4O3S
and a molecular weight of 244.70 g/mol. Its IUPAC name is hydroxylamine;methanesulfonyl chloride;5-methyl-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | hydroxylamine;methanesulfonyl chloride;5-methyl-1H-pyrazol-3-amine |
| PubChem CID | 90745357 |
| Molecular Formula | C5H13ClN4O3S |
| Molecular Weight | 244.70 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | hydroxylamine;methanesulfonyl chloride;5-methyl-1H-pyrazol-3-amine |
| SMILES | CS(=O)(=O)Cl.Cc1cc(N)n[nH]1.NO |
| InChI | InChI=1S/C4H7N3.CH3ClO2S.H3NO/c1-3-2-4(5)7-6-3;1-5(2,3)4;1-2/h2H,1H3,(H3,5,6,7);1H3;2H,1H2 |
| InChIKey | LNJWKNAGXAVAKX-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 135.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.70 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydroxylamine;methanesulfonyl chloride;5-methyl-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxylamine;methanesulfonyl chloride;5-methyl-1H-pyrazol-3-amine?
The IUPAC name of hydroxylamine;methanesulfonyl chloride;5-methyl-1H-pyrazol-3-amine (CID 90745357) is hydroxylamine;methanesulfonyl chloride;5-methyl-1H-pyrazol-3-amine.
What is the SMILES notation for hydroxylamine;methanesulfonyl chloride;5-methyl-1H-pyrazol-3-amine?
The canonical SMILES for hydroxylamine;methanesulfonyl chloride;5-methyl-1H-pyrazol-3-amine is CS(=O)(=O)Cl.Cc1cc(N)n[nH]1.NO.
What is the InChIKey of hydroxylamine;methanesulfonyl chloride;5-methyl-1H-pyrazol-3-amine?
The InChIKey is LNJWKNAGXAVAKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3.CH3ClO2S.H3NO/c1-3-2-4(5)7-6-3;1-5(2,3)4;1-2/h2H,1H3,(H3,5,6,7);1H3;2H,1H2.
What are the key properties of hydroxylamine;methanesulfonyl chloride;5-methyl-1H-pyrazol-3-amine?
hydroxylamine;methanesulfonyl chloride;5-methyl-1H-pyrazol-3-amine has a molecular weight of 244.70 g/mol, XLogP of -0.18, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxylamine;methanesulfonyl chloride;5-methyl-1H-pyrazol-3-amine is sourced from PubChem (CID 90745357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).