C23H23N3O3 — CID 9074543
[2-oxo-2-(N-prop-2-enylanilino)ethyl] 3,5-dimethyl-1-phenylpyrazole-4-carboxylate (PubChem CID 9074543) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is [2-oxo-2-(N-prop-2-enylanilino)ethyl] 3,5-dimethyl-1-phenylpyrazole-4-carboxylate.
| Compound Name | [2-oxo-2-(N-prop-2-enylanilino)ethyl] 3,5-dimethyl-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 9074543 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [2-oxo-2-(N-prop-2-enylanilino)ethyl] 3,5-dimethyl-1-phenylpyrazole-4-carboxylate |
| SMILES | C=CCN(C(=O)COC(=O)c1c(C)nn(-c2ccccc2)c1C)c1ccccc1 |
| InChI | InChI=1S/C23H23N3O3/c1-4-15-25(19-11-7-5-8-12-19)21(27)16-29-23(28)22-17(2)24-26(18(22)3)20-13-9-6-10-14-20/h4-14H,1,15-16H2,2-3H3 |
| InChIKey | OZSNPBNYSHTCGK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|