C12H15N3O2S — CID 90745545
3-piperidin-1-yl-1H-indazole-5-sulfinic acid (PubChem CID 90745545) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 3-piperidin-1-yl-1H-indazole-5-sulfinic acid.
| Compound Name | 3-piperidin-1-yl-1H-indazole-5-sulfinic acid |
|---|---|
| PubChem CID | 90745545 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 3-piperidin-1-yl-1H-indazole-5-sulfinic acid |
| SMILES | O=S(O)c1ccc2[nH]nc(N3CCCCC3)c2c1 |
| InChI | InChI=1S/C12H15N3O2S/c16-18(17)9-4-5-11-10(8-9)12(14-13-11)15-6-2-1-3-7-15/h4-5,8H,1-3,6-7H2,(H,13,14)(H,16,17) |
| InChIKey | QRYCZWULDQLCBD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|