C14H20BNO2 — CID 90745624
(1R,2R,6S)-4-(1-isocyanocyclopropyl)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 90745624) has the molecular formula C14H20BNO2 and a molecular weight of 245.13 g/mol. Its IUPAC name is (1R,2R,6S)-4-(1-isocyanocyclopropyl)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (1R,2R,6S)-4-(1-isocyanocyclopropyl)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 90745624 |
| Molecular Formula | C14H20BNO2 |
| Molecular Weight | 245.13 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | (1R,2R,6S)-4-(1-isocyanocyclopropyl)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | [C-]#[N+]C1(B2O[C@@H]3[C@@H]4CC(C[C@]3(C)O2)C4(C)C)CC1 |
| InChI | InChI=1S/C14H20BNO2/c1-12(2)9-7-10(12)11-13(3,8-9)18-15(17-11)14(16-4)5-6-14/h9-11H,5-8H2,1-3H3/t9?,10-,11+,13-/m0/s1 |
| InChIKey | NMZIKNZLPGKDIJ-UIFQDHKGSA-N |
| XLogP | 2.71 |
| TPSA | 22.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.13 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|