C24H31ClN2O7S — CID 90745857
N-[2-[4-(4-chlorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]ethyl]-N-propylpropan-1-amine;oxalic acid (PubChem CID 90745857) has the molecular formula C24H31ClN2O7S and a molecular weight of 527.04 g/mol. Its IUPAC name is N-[2-[4-(4-chlorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]ethyl]-N-propylpropan-1-amine;oxalic acid.
| Compound Name | N-[2-[4-(4-chlorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]ethyl]-N-propylpropan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 90745857 |
| Molecular Formula | C24H31ClN2O7S |
| Molecular Weight | 527.04 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | N-[2-[4-(4-chlorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]ethyl]-N-propylpropan-1-amine;oxalic acid |
| SMILES | CCCN(CCC)CCc1ccc2c(c1)N(S(=O)(=O)c1ccc(Cl)cc1)CCO2.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H29ClN2O3S.C2H2O4/c1-3-12-24(13-4-2)14-11-18-5-10-22-21(17-18)25(15-16-28-22)29(26,27)20-8-6-19(23)7-9-20;3-1(4)2(5)6/h5-10,17H,3-4,11-16H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | QXJNXHHYWMWUJI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.04 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|