C16H13F5O — CID 90745916
1-ethyl-2-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]benzene (PubChem CID 90745916) has the molecular formula C16H13F5O and a molecular weight of 316.27 g/mol. Its IUPAC name is 1-ethyl-2-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]benzene.
| Compound Name | 1-ethyl-2-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 90745916 |
| Molecular Formula | C16H13F5O |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 1-ethyl-2-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]benzene |
| SMILES | CCc1ccccc1-c1ccc(OC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H13F5O/c1-2-11-5-3-4-6-14(11)12-7-9-13(10-8-12)22-16(20,21)15(17,18)19/h3-10H,2H2,1H3 |
| InChIKey | KZDJBCYXAJEJTJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|