C36H43N4O12S2+ — CID 90746024
[6-(4-acetyl-3,5-dimethoxyphenyl)-3-pyridinyl]-[1-[[6-(4-acetyl-3,5-dimethoxyphenyl)-3-pyridinyl]-methylamino]-3-sulfopropan-2-yl]-methyl-(sulfomethyl)azanium (PubChem CID 90746024) has the molecular formula C36H43N4O12S2+ and a molecular weight of 787.89 g/mol. Its IUPAC name is [6-(4-acetyl-3,5-dimethoxyphenyl)-3-pyridinyl]-[1-[[6-(4-acetyl-3,5-dimethoxyphenyl)-3-pyridinyl]-methylamino]-3-sulfopropan-2-yl]-methyl-(sulfomethyl)azanium.
| Compound Name | [6-(4-acetyl-3,5-dimethoxyphenyl)-3-pyridinyl]-[1-[[6-(4-acetyl-3,5-dimethoxyphenyl)-3-pyridinyl]-methylamino]-3-sulfopropan-2-yl]-methyl-(sulfomethyl)azanium |
|---|---|
| PubChem CID | 90746024 |
| Molecular Formula | C36H43N4O12S2+ |
| Molecular Weight | 787.89 g/mol |
| Exact Mass | 787.23 |
| IUPAC Name | [6-(4-acetyl-3,5-dimethoxyphenyl)-3-pyridinyl]-[1-[[6-(4-acetyl-3,5-dimethoxyphenyl)-3-pyridinyl]-methylamino]-3-sulfopropan-2-yl]-methyl-(sulfomethyl)azanium |
| SMILES | COc1cc(-c2ccc(N(C)CC(CS(=O)(=O)O)[N+](C)(CS(=O)(=O)O)c3ccc(-c4cc(OC)c(C(C)=O)c(OC)c4)nc3)cn2)cc(OC)c1C(C)=O |
| InChI | InChI=1S/C36H42N4O12S2/c1-22(41)35-31(49-5)13-24(14-32(35)50-6)29-11-9-26(17-37-29)39(3)19-28(20-53(43,44)45)40(4,21-54(46,47)48)27-10-12-30(38-18-27)25-15-33(51-7)36(23(2)42)34(16-25)52-8/h9-18,28H,19-21H2,1-8H3,(H-,43,44,45,46,47,48)/p+1 |
| InChIKey | WADOTNRBEYRKPP-UHFFFAOYSA-O |
| XLogP | 4.43 |
| TPSA | 208.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.89 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|