C32H30ClN3O3 — CID 90746370
1-[3-[5-(4-chloro-N-methylanilino)pyridine-2-carbonyl]-5-[N-(oxolan-2-ylmethyl)anilino]phenyl]ethanone (PubChem CID 90746370) has the molecular formula C32H30ClN3O3 and a molecular weight of 540.06 g/mol. Its IUPAC name is 1-[3-[5-(4-chloro-N-methylanilino)pyridine-2-carbonyl]-5-[N-(oxolan-2-ylmethyl)anilino]phenyl]ethanone.
| Compound Name | 1-[3-[5-(4-chloro-N-methylanilino)pyridine-2-carbonyl]-5-[N-(oxolan-2-ylmethyl)anilino]phenyl]ethanone |
|---|---|
| PubChem CID | 90746370 |
| Molecular Formula | C32H30ClN3O3 |
| Molecular Weight | 540.06 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | 1-[3-[5-(4-chloro-N-methylanilino)pyridine-2-carbonyl]-5-[N-(oxolan-2-ylmethyl)anilino]phenyl]ethanone |
| SMILES | CC(=O)c1cc(C(=O)c2ccc(N(C)c3ccc(Cl)cc3)cn2)cc(N(CC2CCCO2)c2ccccc2)c1 |
| InChI | InChI=1S/C32H30ClN3O3/c1-22(37)23-17-24(19-29(18-23)36(21-30-9-6-16-39-30)27-7-4-3-5-8-27)32(38)31-15-14-28(20-34-31)35(2)26-12-10-25(33)11-13-26/h3-5,7-8,10-15,17-20,30H,6,9,16,21H2,1-2H3 |
| InChIKey | FAQCUCZBBMJLTR-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.06 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|