About 2-(2-methyl-1,3-thiazolidin-2-yl)-1,3-thiazole
2-(2-methyl-1,3-thiazolidin-2-yl)-1,3-thiazole (PubChem CID 90746535) has the molecular formula C7H10N2S2
and a molecular weight of 186.31 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazolidin-2-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(2-methyl-1,3-thiazolidin-2-yl)-1,3-thiazole |
| PubChem CID | 90746535 |
| Molecular Formula | C7H10N2S2 |
| Molecular Weight | 186.31 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 2-(2-methyl-1,3-thiazolidin-2-yl)-1,3-thiazole |
| SMILES | CC1(c2nccs2)NCCS1 |
| InChI | InChI=1S/C7H10N2S2/c1-7(9-3-5-11-7)6-8-2-4-10-6/h2,4,9H,3,5H2,1H3 |
| InChIKey | MFLUXVQCMAZDCV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methyl-1,3-thiazolidin-2-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-1,3-thiazolidin-2-yl)-1,3-thiazole?
The IUPAC name of 2-(2-methyl-1,3-thiazolidin-2-yl)-1,3-thiazole (CID 90746535) is 2-(2-methyl-1,3-thiazolidin-2-yl)-1,3-thiazole.
What is the SMILES notation for 2-(2-methyl-1,3-thiazolidin-2-yl)-1,3-thiazole?
The canonical SMILES for 2-(2-methyl-1,3-thiazolidin-2-yl)-1,3-thiazole is CC1(c2nccs2)NCCS1.
What is the InChIKey of 2-(2-methyl-1,3-thiazolidin-2-yl)-1,3-thiazole?
The InChIKey is MFLUXVQCMAZDCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2S2/c1-7(9-3-5-11-7)6-8-2-4-10-6/h2,4,9H,3,5H2,1H3.
What are the key properties of 2-(2-methyl-1,3-thiazolidin-2-yl)-1,3-thiazole?
2-(2-methyl-1,3-thiazolidin-2-yl)-1,3-thiazole has a molecular weight of 186.31 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-1,3-thiazolidin-2-yl)-1,3-thiazole is sourced from PubChem (CID 90746535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).