About cyclopentyl 1-formyloxycyclobutane-1-carboxylate
cyclopentyl 1-formyloxycyclobutane-1-carboxylate (PubChem CID 90746648) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is cyclopentyl 1-formyloxycyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | cyclopentyl 1-formyloxycyclobutane-1-carboxylate |
| PubChem CID | 90746648 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | cyclopentyl 1-formyloxycyclobutane-1-carboxylate |
| SMILES | O=COC1(C(=O)OC2CCCC2)CCC1 |
| InChI | InChI=1S/C11H16O4/c12-8-14-11(6-3-7-11)10(13)15-9-4-1-2-5-9/h8-9H,1-7H2 |
| InChIKey | IUNAWOQNGBWAFM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl 1-formyloxycyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl 1-formyloxycyclobutane-1-carboxylate?
The IUPAC name of cyclopentyl 1-formyloxycyclobutane-1-carboxylate (CID 90746648) is cyclopentyl 1-formyloxycyclobutane-1-carboxylate.
What is the SMILES notation for cyclopentyl 1-formyloxycyclobutane-1-carboxylate?
The canonical SMILES for cyclopentyl 1-formyloxycyclobutane-1-carboxylate is O=COC1(C(=O)OC2CCCC2)CCC1.
What is the InChIKey of cyclopentyl 1-formyloxycyclobutane-1-carboxylate?
The InChIKey is IUNAWOQNGBWAFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O4/c12-8-14-11(6-3-7-11)10(13)15-9-4-1-2-5-9/h8-9H,1-7H2.
What are the key properties of cyclopentyl 1-formyloxycyclobutane-1-carboxylate?
cyclopentyl 1-formyloxycyclobutane-1-carboxylate has a molecular weight of 212.24 g/mol, XLogP of 1.57, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl 1-formyloxycyclobutane-1-carboxylate is sourced from PubChem (CID 90746648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).