C23H33F2NO5S — CID 90746713
methyl 7-[(1R,2R,5S)-2-[4-(2,4-difluorophenyl)sulfanyl-3-hydroxybutyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoate (PubChem CID 90746713) has the molecular formula C23H33F2NO5S and a molecular weight of 473.58 g/mol. Its IUPAC name is methyl 7-[(1R,2R,5S)-2-[4-(2,4-difluorophenyl)sulfanyl-3-hydroxybutyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,5S)-2-[4-(2,4-difluorophenyl)sulfanyl-3-hydroxybutyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 90746713 |
| Molecular Formula | C23H33F2NO5S |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | methyl 7-[(1R,2R,5S)-2-[4-(2,4-difluorophenyl)sulfanyl-3-hydroxybutyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1[C@@H](O)CC(N=O)[C@@H]1CCC(O)CSc1ccc(F)cc1F |
| InChI | InChI=1S/C23H33F2NO5S/c1-31-23(29)7-5-3-2-4-6-18-17(20(26-30)13-21(18)28)10-9-16(27)14-32-22-11-8-15(24)12-19(22)25/h8,11-12,16-18,20-21,27-28H,2-7,9-10,13-14H2,1H3/t16?,17-,18-,20?,21+/m1/s1 |
| InChIKey | OGTYLYFJPVKPGI-BWUDXWKYSA-N |
| XLogP | 4.84 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|