About 1-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]propan-2-amine
1-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]propan-2-amine (PubChem CID 90746753) has the molecular formula C10H10Cl2F3N3
and a molecular weight of 300.11 g/mol. Its IUPAC name is 1-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]propan-2-amine.
Molecular Properties
| Compound Name | 1-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]propan-2-amine |
| PubChem CID | 90746753 |
| Molecular Formula | C10H10Cl2F3N3 |
| Molecular Weight | 300.11 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 1-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]propan-2-amine |
| SMILES | CC(N)C/N=N/c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H10Cl2F3N3/c1-5(16)4-17-18-9-7(11)2-6(3-8(9)12)10(13,14)15/h2-3,5H,4,16H2,1H3/b18-17+ |
| InChIKey | VJNPPCQLOBCAHV-ISLYRVAYSA-N |
| XLogP | 4.44 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.11 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]propan-2-amine?
The IUPAC name of 1-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]propan-2-amine (CID 90746753) is 1-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]propan-2-amine.
What is the SMILES notation for 1-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]propan-2-amine?
The canonical SMILES for 1-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]propan-2-amine is CC(N)C/N=N/c1c(Cl)cc(C(F)(F)F)cc1Cl.
What is the InChIKey of 1-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]propan-2-amine?
The InChIKey is VJNPPCQLOBCAHV-ISLYRVAYSA-N. The full InChI is InChI=1S/C10H10Cl2F3N3/c1-5(16)4-17-18-9-7(11)2-6(3-8(9)12)10(13,14)15/h2-3,5H,4,16H2,1H3/b18-17+.
What are the key properties of 1-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]propan-2-amine?
1-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]propan-2-amine has a molecular weight of 300.11 g/mol, XLogP of 4.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2,6-dichloro-4-(trifluoromethyl)phenyl]diazenyl]propan-2-amine is sourced from PubChem (CID 90746753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).