C28H25FN2O7 — CID 90747164
(5R)-7-[1-(4-fluorophenoxy)propan-2-yl]-4-methyl-2-(4-nitronaphthalen-1-yl)-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol (PubChem CID 90747164) has the molecular formula C28H25FN2O7 and a molecular weight of 520.51 g/mol. Its IUPAC name is (5R)-7-[1-(4-fluorophenoxy)propan-2-yl]-4-methyl-2-(4-nitronaphthalen-1-yl)-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol.
| Compound Name | (5R)-7-[1-(4-fluorophenoxy)propan-2-yl]-4-methyl-2-(4-nitronaphthalen-1-yl)-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol |
|---|---|
| PubChem CID | 90747164 |
| Molecular Formula | C28H25FN2O7 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | (5R)-7-[1-(4-fluorophenoxy)propan-2-yl]-4-methyl-2-(4-nitronaphthalen-1-yl)-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol |
| SMILES | CC(COc1ccc(F)cc1)C12C[C@@H](O)C(C)(O1)c1c2c(O)n(-c2ccc([N+](=O)[O-])c3ccccc23)c1O |
| InChI | InChI=1S/C28H25FN2O7/c1-15(14-37-17-9-7-16(29)8-10-17)28-13-22(32)27(2,38-28)23-24(28)26(34)30(25(23)33)20-11-12-21(31(35)36)19-6-4-3-5-18(19)20/h3-12,15,22,32-34H,13-14H2,1-2H3/t15?,22-,27?,28?/m1/s1 |
| InChIKey | XRNNCPRDOQFLSE-QXZKOEEHSA-N |
| XLogP | 5.01 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|